C25H27FN2O5 — CID 4757692
5-(4-fluorophenyl)-4-(4-methoxy-2-methylbenzoyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione (PubChem CID 4757692) has the molecular formula C25H27FN2O5 and a molecular weight of 454.50 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-(4-methoxy-2-methylbenzoyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-fluorophenyl)-4-(4-methoxy-2-methylbenzoyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4757692 |
| Molecular Formula | C25H27FN2O5 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 5-(4-fluorophenyl)-4-(4-methoxy-2-methylbenzoyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(CCN3CCOCC3)C2c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C25H27FN2O5/c1-16-15-19(32-2)7-8-20(16)23(29)21-22(17-3-5-18(26)6-4-17)28(25(31)24(21)30)10-9-27-11-13-33-14-12-27/h3-8,15,21-22H,9-14H2,1-2H3 |
| InChIKey | KDLGRNQHIBBMTE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|