C26H30N2O7 — CID 4757739
5-(4-hydroxy-3-methoxyphenyl)-4-(4-methoxy-2-methylbenzoyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione (PubChem CID 4757739) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is 5-(4-hydroxy-3-methoxyphenyl)-4-(4-methoxy-2-methylbenzoyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-hydroxy-3-methoxyphenyl)-4-(4-methoxy-2-methylbenzoyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4757739 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 5-(4-hydroxy-3-methoxyphenyl)-4-(4-methoxy-2-methylbenzoyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(CCN3CCOCC3)C2c2ccc(O)c(OC)c2)c(C)c1 |
| InChI | InChI=1S/C26H30N2O7/c1-16-14-18(33-2)5-6-19(16)24(30)22-23(17-4-7-20(29)21(15-17)34-3)28(26(32)25(22)31)9-8-27-10-12-35-13-11-27/h4-7,14-15,22-23,29H,8-13H2,1-3H3 |
| InChIKey | RDUSLRDHDKQQMR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|