C27H33N2O6+ — CID 4757666
4-(4-methoxy-2-methylbenzoyl)-5-(2-methoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 4757666) has the molecular formula C27H33N2O6+ and a molecular weight of 481.57 g/mol. Its IUPAC name is 4-(4-methoxy-2-methylbenzoyl)-5-(2-methoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | 4-(4-methoxy-2-methylbenzoyl)-5-(2-methoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4757666 |
| Molecular Formula | C27H33N2O6+ |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 4-(4-methoxy-2-methylbenzoyl)-5-(2-methoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(CCC[NH+]3CCOCC3)C2c2ccccc2OC)c(C)c1 |
| InChI | InChI=1S/C27H32N2O6/c1-18-17-19(33-2)9-10-20(18)25(30)23-24(21-7-4-5-8-22(21)34-3)29(27(32)26(23)31)12-6-11-28-13-15-35-16-14-28/h4-5,7-10,17,23-24H,6,11-16H2,1-3H3/p+1 |
| InChIKey | OXEBHSBFNUIOPA-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|