C25H31N2O5+ — CID 4757504
3-[3-(4-methoxy-2-methylbenzoyl)-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 4757504) has the molecular formula C25H31N2O5+ and a molecular weight of 439.53 g/mol. Its IUPAC name is 3-[3-(4-methoxy-2-methylbenzoyl)-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[3-(4-methoxy-2-methylbenzoyl)-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 4757504 |
| Molecular Formula | C25H31N2O5+ |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 3-[3-(4-methoxy-2-methylbenzoyl)-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(CCC[NH+](C)C)C2c2ccccc2OC)c(C)c1 |
| InChI | InChI=1S/C25H30N2O5/c1-16-15-17(31-4)11-12-18(16)23(28)21-22(19-9-6-7-10-20(19)32-5)27(25(30)24(21)29)14-8-13-26(2)3/h6-7,9-12,15,21-22H,8,13-14H2,1-5H3/p+1 |
| InChIKey | MSNTXOHXWJPEOY-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|