C25H32N3O4+ — CID 4756985
3-[2-[4-(dimethylamino)phenyl]-3-(4-methoxybenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 4756985) has the molecular formula C25H32N3O4+ and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-[2-[4-(dimethylamino)phenyl]-3-(4-methoxybenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[2-[4-(dimethylamino)phenyl]-3-(4-methoxybenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 4756985 |
| Molecular Formula | C25H32N3O4+ |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 3-[2-[4-(dimethylamino)phenyl]-3-(4-methoxybenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(CCC[NH+](C)C)C2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H31N3O4/c1-26(2)15-6-16-28-22(17-7-11-19(12-8-17)27(3)4)21(24(30)25(28)31)23(29)18-9-13-20(32-5)14-10-18/h7-14,21-22H,6,15-16H2,1-5H3/p+1 |
| InChIKey | XQEYRVKWFSUVAI-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|