C26H33N2O6+ — CID 4758176
3-[2-(3-ethoxy-4-hydroxyphenyl)-3-(4-methoxy-3-methylbenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 4758176) has the molecular formula C26H33N2O6+ and a molecular weight of 469.56 g/mol. Its IUPAC name is 3-[2-(3-ethoxy-4-hydroxyphenyl)-3-(4-methoxy-3-methylbenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[2-(3-ethoxy-4-hydroxyphenyl)-3-(4-methoxy-3-methylbenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 4758176 |
| Molecular Formula | C26H33N2O6+ |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 3-[2-(3-ethoxy-4-hydroxyphenyl)-3-(4-methoxy-3-methylbenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | CCOc1cc(C2C(C(=O)c3ccc(OC)c(C)c3)C(=O)C(=O)N2CCC[NH+](C)C)ccc1O |
| InChI | InChI=1S/C26H32N2O6/c1-6-34-21-15-17(8-10-19(21)29)23-22(24(30)18-9-11-20(33-5)16(2)14-18)25(31)26(32)28(23)13-7-12-27(3)4/h8-11,14-15,22-23,29H,6-7,12-13H2,1-5H3/p+1 |
| InChIKey | WTOLOPZFZKGCGD-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|