C24H27Cl2N2O4+ — CID 4751542
3-[2-(3,4-dichlorophenyl)-3-(4-methoxy-3-methylbenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 4751542) has the molecular formula C24H27Cl2N2O4+ and a molecular weight of 478.40 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)-3-(4-methoxy-3-methylbenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[2-(3,4-dichlorophenyl)-3-(4-methoxy-3-methylbenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 4751542 |
| Molecular Formula | C24H27Cl2N2O4+ |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 3-[2-(3,4-dichlorophenyl)-3-(4-methoxy-3-methylbenzoyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(CCC[NH+](C)C)C2c2ccc(Cl)c(Cl)c2)cc1C |
| InChI | InChI=1S/C24H26Cl2N2O4/c1-14-12-16(7-9-19(14)32-4)22(29)20-21(15-6-8-17(25)18(26)13-15)28(24(31)23(20)30)11-5-10-27(2)3/h6-9,12-13,20-21H,5,10-11H2,1-4H3/p+1 |
| InChIKey | QWCRMLYIJNHHEG-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|