C24H26Cl2N2O4 — CID 4005610
[2-(2,4-dichlorophenyl)-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-methoxy-3-methylphenyl)methanolate (PubChem CID 4005610) has the molecular formula C24H26Cl2N2O4 and a molecular weight of 477.39 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-methoxy-3-methylphenyl)methanolate.
| Compound Name | [2-(2,4-dichlorophenyl)-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-methoxy-3-methylphenyl)methanolate |
|---|---|
| PubChem CID | 4005610 |
| Molecular Formula | C24H26Cl2N2O4 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-methoxy-3-methylphenyl)methanolate |
| SMILES | COc1ccc(C([O-])=C2C(=O)C(=O)N(CCC[NH+](C)C)C2c2ccc(Cl)cc2Cl)cc1C |
| InChI | InChI=1S/C24H26Cl2N2O4/c1-14-12-15(6-9-19(14)32-4)22(29)20-21(17-8-7-16(25)13-18(17)26)28(24(31)23(20)30)11-5-10-27(2)3/h6-9,12-13,21,29H,5,10-11H2,1-4H3 |
| InChIKey | KPAVILHIMNYDNO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 74.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|