C24H27BrN2O5 — CID 3909105
(4-bromophenyl)-[2-(2,5-dimethoxyphenyl)-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 3909105) has the molecular formula C24H27BrN2O5 and a molecular weight of 503.39 g/mol. Its IUPAC name is (4-bromophenyl)-[2-(2,5-dimethoxyphenyl)-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | (4-bromophenyl)-[2-(2,5-dimethoxyphenyl)-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 3909105 |
| Molecular Formula | C24H27BrN2O5 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | (4-bromophenyl)-[2-(2,5-dimethoxyphenyl)-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | COc1ccc(OC)c(C2C(=C([O-])c3ccc(Br)cc3)C(=O)C(=O)N2CCC[NH+](C)C)c1 |
| InChI | InChI=1S/C24H27BrN2O5/c1-26(2)12-5-13-27-21(18-14-17(31-3)10-11-19(18)32-4)20(23(29)24(27)30)22(28)15-6-8-16(25)9-7-15/h6-11,14,21,28H,5,12-13H2,1-4H3 |
| InChIKey | HKHDWGJMJHHCJK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|