C26H31FN2O6 — CID 3532378
[2-(2,5-dimethoxyphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate (PubChem CID 3532378) has the molecular formula C26H31FN2O6 and a molecular weight of 486.54 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate |
|---|---|
| PubChem CID | 3532378 |
| Molecular Formula | C26H31FN2O6 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate |
| SMILES | COc1ccc(OC)c(C2C(=C([O-])c3ccc(OC(C)C)c(F)c3)C(=O)C(=O)N2CC[NH+](C)C)c1 |
| InChI | InChI=1S/C26H31FN2O6/c1-15(2)35-21-9-7-16(13-19(21)27)24(30)22-23(18-14-17(33-5)8-10-20(18)34-6)29(12-11-28(3)4)26(32)25(22)31/h7-10,13-15,23,30H,11-12H2,1-6H3 |
| InChIKey | QYNYJLVXUPCVNU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|