C29H37FN2O5 — CID 5042784
[1-[3-(diethylazaniumyl)propyl]-2-(4-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate (PubChem CID 5042784) has the molecular formula C29H37FN2O5 and a molecular weight of 512.62 g/mol. Its IUPAC name is [1-[3-(diethylazaniumyl)propyl]-2-(4-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate.
| Compound Name | [1-[3-(diethylazaniumyl)propyl]-2-(4-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate |
|---|---|
| PubChem CID | 5042784 |
| Molecular Formula | C29H37FN2O5 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | [1-[3-(diethylazaniumyl)propyl]-2-(4-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate |
| SMILES | CCOc1ccc(C2C(=C([O-])c3ccc(OC(C)C)c(F)c3)C(=O)C(=O)N2CCC[NH+](CC)CC)cc1 |
| InChI | InChI=1S/C29H37FN2O5/c1-6-31(7-2)16-9-17-32-26(20-10-13-22(14-11-20)36-8-3)25(28(34)29(32)35)27(33)21-12-15-24(23(30)18-21)37-19(4)5/h10-15,18-19,26,33H,6-9,16-17H2,1-5H3 |
| InChIKey | YEIVCLOKSPSVEC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|