C26H32FN3O4 — CID 5132065
[1-[3-(diethylazaniumyl)propyl]-4,5-dioxo-2-pyridin-3-ylpyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate (PubChem CID 5132065) has the molecular formula C26H32FN3O4 and a molecular weight of 469.56 g/mol. Its IUPAC name is [1-[3-(diethylazaniumyl)propyl]-4,5-dioxo-2-pyridin-3-ylpyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate.
| Compound Name | [1-[3-(diethylazaniumyl)propyl]-4,5-dioxo-2-pyridin-3-ylpyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate |
|---|---|
| PubChem CID | 5132065 |
| Molecular Formula | C26H32FN3O4 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | [1-[3-(diethylazaniumyl)propyl]-4,5-dioxo-2-pyridin-3-ylpyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate |
| SMILES | CC[NH+](CC)CCCN1C(=O)C(=O)C(=C([O-])c2ccc(OC(C)C)c(F)c2)C1c1cccnc1 |
| InChI | InChI=1S/C26H32FN3O4/c1-5-29(6-2)13-8-14-30-23(19-9-7-12-28-16-19)22(25(32)26(30)33)24(31)18-10-11-21(20(27)15-18)34-17(3)4/h7,9-12,15-17,23,31H,5-6,8,13-14H2,1-4H3 |
| InChIKey | RJQAZUKCHVMRSX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|