C24H30N3O3+ — CID 6964289
diethyl-[3-[(5S)-4-[hydroxy-(4-methylphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl]azanium (PubChem CID 6964289) has the molecular formula C24H30N3O3+ and a molecular weight of 408.52 g/mol. Its IUPAC name is diethyl-[3-[(5S)-4-[hydroxy-(4-methylphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl]azanium.
| Compound Name | diethyl-[3-[(5S)-4-[hydroxy-(4-methylphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl]azanium |
|---|---|
| PubChem CID | 6964289 |
| Molecular Formula | C24H30N3O3+ |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | diethyl-[3-[(5S)-4-[hydroxy-(4-methylphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl]azanium |
| SMILES | CC[NH+](CC)CCCN1C(=O)C(=O)C(=C(O)c2ccc(C)cc2)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C24H29N3O3/c1-4-26(5-2)14-7-15-27-21(19-8-6-13-25-16-19)20(23(29)24(27)30)22(28)18-11-9-17(3)10-12-18/h6,8-13,16,21,28H,4-5,7,14-15H2,1-3H3/p+1/t21-/m0/s1 |
| InChIKey | CJEIBYKBLLKQDL-NRFANRHFSA-O |
| XLogP | 2.13 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|