C22H25ClN3O3+ — CID 7381824
2-[(5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]ethyl-diethylazanium (PubChem CID 7381824) has the molecular formula C22H25ClN3O3+ and a molecular weight of 414.91 g/mol. Its IUPAC name is 2-[(5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]ethyl-diethylazanium.
| Compound Name | 2-[(5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7381824 |
| Molecular Formula | C22H25ClN3O3+ |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[(5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-3-25(4-2)12-13-26-19(16-6-5-11-24-14-16)18(21(28)22(26)29)20(27)15-7-9-17(23)10-8-15/h5-11,14,19,27H,3-4,12-13H2,1-2H3/p+1/t19-/m0/s1 |
| InChIKey | NAWCHYGPAKNFFV-IBGZPJMESA-O |
| XLogP | 2.08 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|