C27H34ClN3O3 — CID 4645063
4-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(dibutylamino)propyl]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 4645063) has the molecular formula C27H34ClN3O3 and a molecular weight of 484.04 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(dibutylamino)propyl]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(dibutylamino)propyl]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4645063 |
| Molecular Formula | C27H34ClN3O3 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(dibutylamino)propyl]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | CCCCN(CCCC)CCCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)C1c1cccnc1 |
| InChI | InChI=1S/C27H34ClN3O3/c1-3-5-15-30(16-6-4-2)17-8-18-31-24(21-9-7-14-29-19-21)23(26(33)27(31)34)25(32)20-10-12-22(28)13-11-20/h7,9-14,19,24,32H,3-6,8,15-18H2,1-2H3 |
| InChIKey | OTSCKNRTASYKPF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|