C28H34ClFN2O3 — CID 4162384
5-(4-chlorophenyl)-1-[3-(dibutylamino)propyl]-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 4162384) has the molecular formula C28H34ClFN2O3 and a molecular weight of 501.04 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-[3-(dibutylamino)propyl]-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | 5-(4-chlorophenyl)-1-[3-(dibutylamino)propyl]-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4162384 |
| Molecular Formula | C28H34ClFN2O3 |
| Molecular Weight | 501.04 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 5-(4-chlorophenyl)-1-[3-(dibutylamino)propyl]-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCN(CCCC)CCCN1C(=O)C(=O)C(=C(O)c2ccc(F)cc2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H34ClFN2O3/c1-3-5-16-31(17-6-4-2)18-7-19-32-25(20-8-12-22(29)13-9-20)24(27(34)28(32)35)26(33)21-10-14-23(30)15-11-21/h8-15,25,33H,3-7,16-19H2,1-2H3 |
| InChIKey | XLLCPOGMCJXDCH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.04 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|