C32H43ClN2O3 — CID 6088968
(4E)-5-(4-tert-butylphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(dibutylamino)propyl]pyrrolidine-2,3-dione (PubChem CID 6088968) has the molecular formula C32H43ClN2O3 and a molecular weight of 539.16 g/mol. Its IUPAC name is (4E)-5-(4-tert-butylphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(dibutylamino)propyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-tert-butylphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(dibutylamino)propyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6088968 |
| Molecular Formula | C32H43ClN2O3 |
| Molecular Weight | 539.16 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | (4E)-5-(4-tert-butylphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[3-(dibutylamino)propyl]pyrrolidine-2,3-dione |
| SMILES | CCCCN(CCCC)CCCN1C(=O)C(=O)/C(=C(/O)c2ccc(Cl)cc2)C1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H43ClN2O3/c1-6-8-19-34(20-9-7-2)21-10-22-35-28(23-11-15-25(16-12-23)32(3,4)5)27(30(37)31(35)38)29(36)24-13-17-26(33)18-14-24/h11-18,28,36H,6-10,19-22H2,1-5H3/b29-27+ |
| InChIKey | PVDZSMQDVVOKGT-ORIPQNMZSA-N |
| XLogP | 7.35 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.16 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|