C25H31ClN3O3+ — CID 6977895
2-[(2S)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-[4-(dimethylamino)phenyl]-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium (PubChem CID 6977895) has the molecular formula C25H31ClN3O3+ and a molecular weight of 456.99 g/mol. Its IUPAC name is 2-[(2S)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-[4-(dimethylamino)phenyl]-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium.
| Compound Name | 2-[(2S)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-[4-(dimethylamino)phenyl]-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 6977895 |
| Molecular Formula | C25H31ClN3O3+ |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 2-[(2S)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-[4-(dimethylamino)phenyl]-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)[C@@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C25H30ClN3O3/c1-5-28(6-2)15-16-29-22(17-9-13-20(14-10-17)27(3)4)21(24(31)25(29)32)23(30)18-7-11-19(26)12-8-18/h7-14,22,30H,5-6,15-16H2,1-4H3/p+1/t22-/m0/s1 |
| InChIKey | QGZLBLFXZYVCFW-QFIPXVFZSA-O |
| XLogP | 2.75 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|