C23H27ClN3O5S+ — CID 4757185
2-[2-(4-chlorophenyl)-3-[[4-(dimethylsulfamoyl)phenyl]-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium (PubChem CID 4757185) has the molecular formula C23H27ClN3O5S+ and a molecular weight of 493.01 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-3-[[4-(dimethylsulfamoyl)phenyl]-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium.
| Compound Name | 2-[2-(4-chlorophenyl)-3-[[4-(dimethylsulfamoyl)phenyl]-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 4757185 |
| Molecular Formula | C23H27ClN3O5S+ |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-3-[[4-(dimethylsulfamoyl)phenyl]-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(O)=C2C(=O)C(=O)N(CC[NH+](C)C)C2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H26ClN3O5S/c1-25(2)13-14-27-20(15-5-9-17(24)10-6-15)19(22(29)23(27)30)21(28)16-7-11-18(12-8-16)33(31,32)26(3)4/h5-12,20,28H,13-14H2,1-4H3/p+1 |
| InChIKey | GDZWXDQIAWUWHP-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|