C28H35FN2O4 — CID 5023087
[2-(4-tert-butylphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate (PubChem CID 5023087) has the molecular formula C28H35FN2O4 and a molecular weight of 482.60 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate.
| Compound Name | [2-(4-tert-butylphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate |
|---|---|
| PubChem CID | 5023087 |
| Molecular Formula | C28H35FN2O4 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | [2-(4-tert-butylphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-fluoro-4-propan-2-yloxyphenyl)methanolate |
| SMILES | CC(C)Oc1ccc(C([O-])=C2C(=O)C(=O)N(CC[NH+](C)C)C2c2ccc(C(C)(C)C)cc2)cc1F |
| InChI | InChI=1S/C28H35FN2O4/c1-17(2)35-22-13-10-19(16-21(22)29)25(32)23-24(18-8-11-20(12-9-18)28(3,4)5)31(15-14-30(6)7)27(34)26(23)33/h8-13,16-17,24,32H,14-15H2,1-7H3 |
| InChIKey | XRAOJIYTMPNRAS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|