C26H31ClN2O4 — CID 3888770
[2-(4-tert-butylphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-chloro-4-methoxyphenyl)methanolate (PubChem CID 3888770) has the molecular formula C26H31ClN2O4 and a molecular weight of 471.00 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-chloro-4-methoxyphenyl)methanolate.
| Compound Name | [2-(4-tert-butylphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-chloro-4-methoxyphenyl)methanolate |
|---|---|
| PubChem CID | 3888770 |
| Molecular Formula | C26H31ClN2O4 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | [2-(4-tert-butylphenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-chloro-4-methoxyphenyl)methanolate |
| SMILES | COc1ccc(C([O-])=C2C(=O)C(=O)N(CC[NH+](C)C)C2c2ccc(C(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C26H31ClN2O4/c1-26(2,3)18-10-7-16(8-11-18)22-21(24(31)25(32)29(22)14-13-28(4)5)23(30)17-9-12-20(33-6)19(27)15-17/h7-12,15,22,30H,13-14H2,1-6H3 |
| InChIKey | HHKDCGVSUQFAQS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|