C30H39ClN2O4 — CID 6092254
(E)-[2-(4-tert-butylphenyl)-1-[3-(diethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-chloro-4-ethoxyphenyl)methanolate (PubChem CID 6092254) has the molecular formula C30H39ClN2O4 and a molecular weight of 527.11 g/mol. Its IUPAC name is (E)-[2-(4-tert-butylphenyl)-1-[3-(diethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-chloro-4-ethoxyphenyl)methanolate.
| Compound Name | (E)-[2-(4-tert-butylphenyl)-1-[3-(diethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-chloro-4-ethoxyphenyl)methanolate |
|---|---|
| PubChem CID | 6092254 |
| Molecular Formula | C30H39ClN2O4 |
| Molecular Weight | 527.11 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | (E)-[2-(4-tert-butylphenyl)-1-[3-(diethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(3-chloro-4-ethoxyphenyl)methanolate |
| SMILES | CCOc1ccc(/C([O-])=C2\C(=O)C(=O)N(CCC[NH+](CC)CC)C2c2ccc(C(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C30H39ClN2O4/c1-7-32(8-2)17-10-18-33-26(20-11-14-22(15-12-20)30(4,5)6)25(28(35)29(33)36)27(34)21-13-16-24(37-9-3)23(31)19-21/h11-16,19,26,34H,7-10,17-18H2,1-6H3/b27-25+ |
| InChIKey | OMYTVXQYRZJJJG-IMVLJIQESA-N |
| XLogP | 3.58 |
| TPSA | 74.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.11 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|