C28H33ClN2O6 — CID 3924854
(3-chloro-4-ethoxyphenyl)-[1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 3924854) has the molecular formula C28H33ClN2O6 and a molecular weight of 529.03 g/mol. Its IUPAC name is (3-chloro-4-ethoxyphenyl)-[1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | (3-chloro-4-ethoxyphenyl)-[1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 3924854 |
| Molecular Formula | C28H33ClN2O6 |
| Molecular Weight | 529.03 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | (3-chloro-4-ethoxyphenyl)-[1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | CCOc1ccc(C([O-])=C2C(=O)C(=O)N(CCC[NH+](CC)CC)C2c2ccc(C(=O)OC)cc2)cc1Cl |
| InChI | InChI=1S/C28H33ClN2O6/c1-5-30(6-2)15-8-16-31-24(18-9-11-19(12-10-18)28(35)36-4)23(26(33)27(31)34)25(32)20-13-14-22(37-7-3)21(29)17-20/h9-14,17,24,32H,5-8,15-16H2,1-4H3 |
| InChIKey | SNKOUPBOEIENBV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.03 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|