C28H32N4O5 — CID 4026752
[1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanolate (PubChem CID 4026752) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is [1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanolate.
| Compound Name | [1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanolate |
|---|---|
| PubChem CID | 4026752 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | [1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanolate |
| SMILES | CC[NH+](CC)CCCN1C(=O)C(=O)C(=C([O-])c2c(C)nc3ccccn23)C1c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C28H32N4O5/c1-5-30(6-2)15-9-17-32-24(19-11-13-20(14-12-19)28(36)37-4)22(26(34)27(32)35)25(33)23-18(3)29-21-10-7-8-16-31(21)23/h7-8,10-14,16,24,33H,5-6,9,15,17H2,1-4H3 |
| InChIKey | OJNSIHQEMZVUCY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|