C27H32N2O6 — CID 5094980
[1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(3-methoxyphenyl)methanolate (PubChem CID 5094980) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is [1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(3-methoxyphenyl)methanolate.
| Compound Name | [1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(3-methoxyphenyl)methanolate |
|---|---|
| PubChem CID | 5094980 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | [1-[3-(diethylazaniumyl)propyl]-2-(4-methoxycarbonylphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(3-methoxyphenyl)methanolate |
| SMILES | CC[NH+](CC)CCCN1C(=O)C(=O)C(=C([O-])c2cccc(OC)c2)C1c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C27H32N2O6/c1-5-28(6-2)15-8-16-29-23(18-11-13-19(14-12-18)27(33)35-4)22(25(31)26(29)32)24(30)20-9-7-10-21(17-20)34-3/h7,9-14,17,23,30H,5-6,8,15-16H2,1-4H3 |
| InChIKey | YVEMTHNLQHWHRK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|