C25H29N4O3+ — CID 4114843
3-[3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-2-(4-methylphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 4114843) has the molecular formula C25H29N4O3+ and a molecular weight of 433.53 g/mol. Its IUPAC name is 3-[3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-2-(4-methylphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-2-(4-methylphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 4114843 |
| Molecular Formula | C25H29N4O3+ |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 3-[3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-2-(4-methylphenyl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | Cc1ccc(C2C(=C(O)c3c(C)nc4ccccn34)C(=O)C(=O)N2CCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C25H28N4O3/c1-16-9-11-18(12-10-16)22-20(24(31)25(32)29(22)15-7-13-27(3)4)23(30)21-17(2)26-19-8-5-6-14-28(19)21/h5-6,8-12,14,22,30H,7,13,15H2,1-4H3/p+1 |
| InChIKey | ISQGXMBGDIEIJG-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|