C23H24FN4O3+ — CID 7182721
2-[(2R,3E)-2-(2-fluorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium (PubChem CID 7182721) has the molecular formula C23H24FN4O3+ and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[(2R,3E)-2-(2-fluorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium.
| Compound Name | 2-[(2R,3E)-2-(2-fluorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7182721 |
| Molecular Formula | C23H24FN4O3+ |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[(2R,3E)-2-(2-fluorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
| SMILES | Cc1nc2ccccn2c1/C(O)=C1\C(=O)C(=O)N(CC[NH+](C)C)[C@H]1c1ccccc1F |
| InChI | InChI=1S/C23H23FN4O3/c1-14-19(27-11-7-6-10-17(27)25-14)21(29)18-20(15-8-4-5-9-16(15)24)28(13-12-26(2)3)23(31)22(18)30/h4-11,20,29H,12-13H2,1-3H3/p+1/b21-18+/t20-/m0/s1 |
| InChIKey | HWTVGXOWXSUWTH-ASBZNUFUSA-O |
| XLogP | 1.35 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|