C27H32N4O4 — CID 3894081
[1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-(4-propoxyphenyl)pyrrolidin-3-ylidene]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanolate (PubChem CID 3894081) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is [1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-(4-propoxyphenyl)pyrrolidin-3-ylidene]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanolate.
| Compound Name | [1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-(4-propoxyphenyl)pyrrolidin-3-ylidene]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanolate |
|---|---|
| PubChem CID | 3894081 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [1-[3-(dimethylazaniumyl)propyl]-4,5-dioxo-2-(4-propoxyphenyl)pyrrolidin-3-ylidene]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanolate |
| SMILES | CCCOc1ccc(C2C(=C([O-])c3c(C)nc4ccccn34)C(=O)C(=O)N2CCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C27H32N4O4/c1-5-17-35-20-12-10-19(11-13-20)24-22(26(33)27(34)31(24)16-8-14-29(3)4)25(32)23-18(2)28-21-9-6-7-15-30(21)23/h6-7,9-13,15,24,32H,5,8,14,16-17H2,1-4H3 |
| InChIKey | RXUFSCGWJASRTA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|