C31H31N3O4 — CID 6188802
(4E)-5-(4-butoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 6188802) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is (4E)-5-(4-butoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-butoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6188802 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (4E)-5-(4-butoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc(C2/C(=C(\O)c3c(C)nc4ccccn34)C(=O)C(=O)N2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H31N3O4/c1-3-4-20-38-24-15-13-23(14-16-24)28-26(29(35)27-21(2)32-25-12-8-9-18-33(25)27)30(36)31(37)34(28)19-17-22-10-6-5-7-11-22/h5-16,18,28,35H,3-4,17,19-20H2,1-2H3/b29-26+ |
| InChIKey | FCRKCYVGEPFDTF-PBBVDAKRSA-N |
| XLogP | 5.49 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|