C34H37N3O5 — CID 4696083
5-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 4696083) has the molecular formula C34H37N3O5 and a molecular weight of 567.69 g/mol. Its IUPAC name is 5-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4696083 |
| Molecular Formula | C34H37N3O5 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 5-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2C(=C(O)c3c(C)nc4ccccn34)C(=O)C(=O)N2CCc2ccccc2)ccc1OCCC(C)C |
| InChI | InChI=1S/C34H37N3O5/c1-5-41-27-21-25(14-15-26(27)42-20-17-22(2)3)31-29(32(38)30-23(4)35-28-13-9-10-18-36(28)30)33(39)34(40)37(31)19-16-24-11-7-6-8-12-24/h6-15,18,21-22,31,38H,5,16-17,19-20H2,1-4H3 |
| InChIKey | YCOVXFQXCYCQDP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|