C25H29N2O7+ — CID 4750186
2-[3-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium (PubChem CID 4750186) has the molecular formula C25H29N2O7+ and a molecular weight of 469.51 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium.
| Compound Name | 2-[3-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 4750186 |
| Molecular Formula | C25H29N2O7+ |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[3-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
| SMILES | COc1ccc(OC)c(C2C(C(=O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CC[NH+](C)C)c1 |
| InChI | InChI=1S/C25H28N2O7/c1-26(2)9-10-27-22(17-14-16(31-3)6-8-18(17)32-4)21(24(29)25(27)30)23(28)15-5-7-19-20(13-15)34-12-11-33-19/h5-8,13-14,21-22H,9-12H2,1-4H3/p+1 |
| InChIKey | BVZFFQLKQAXAOI-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|