C25H31N2O5+ — CID 4750889
2-[3-benzoyl-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium (PubChem CID 4750889) has the molecular formula C25H31N2O5+ and a molecular weight of 439.53 g/mol. Its IUPAC name is 2-[3-benzoyl-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium.
| Compound Name | 2-[3-benzoyl-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 4750889 |
| Molecular Formula | C25H31N2O5+ |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 2-[3-benzoyl-2-(2,5-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCN1C(=O)C(=O)C(C(=O)c2ccccc2)C1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C25H30N2O5/c1-5-26(6-2)14-15-27-22(19-16-18(31-3)12-13-20(19)32-4)21(24(29)25(27)30)23(28)17-10-8-7-9-11-17/h7-13,16,21-22H,5-6,14-15H2,1-4H3/p+1 |
| InChIKey | VXWYIYLTWCRVJW-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|