C23H29N2O4+ — CID 4753092
3-[3-(2,5-dimethylbenzoyl)-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 4753092) has the molecular formula C23H29N2O4+ and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-[3-(2,5-dimethylbenzoyl)-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[3-(2,5-dimethylbenzoyl)-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 4753092 |
| Molecular Formula | C23H29N2O4+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 3-[3-(2,5-dimethylbenzoyl)-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | Cc1ccc(C)c(C(=O)C2C(=O)C(=O)N(CCC[NH+](C)C)C2c2ccc(C)o2)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-14-7-8-15(2)17(13-14)21(26)19-20(18-10-9-16(3)29-18)25(23(28)22(19)27)12-6-11-24(4)5/h7-10,13,19-20H,6,11-12H2,1-5H3/p+1 |
| InChIKey | DDHQUIHFXTZAHZ-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|