C26H30FN2O4+ — CID 4120453
4-(2,5-dimethylbenzoyl)-5-(4-fluorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 4120453) has the molecular formula C26H30FN2O4+ and a molecular weight of 453.53 g/mol. Its IUPAC name is 4-(2,5-dimethylbenzoyl)-5-(4-fluorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | 4-(2,5-dimethylbenzoyl)-5-(4-fluorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4120453 |
| Molecular Formula | C26H30FN2O4+ |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 4-(2,5-dimethylbenzoyl)-5-(4-fluorophenyl)-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C)c(C(=O)C2C(=O)C(=O)N(CCC[NH+]3CCOCC3)C2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H29FN2O4/c1-17-4-5-18(2)21(16-17)24(30)22-23(19-6-8-20(27)9-7-19)29(26(32)25(22)31)11-3-10-28-12-14-33-15-13-28/h4-9,16,22-23H,3,10-15H2,1-2H3/p+1 |
| InChIKey | PQOUHUITYVHZAH-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|