C29H31N2O5+ — CID 4757044
4-(4-methoxybenzoyl)-1-(3-morpholin-4-ium-4-ylpropyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione (PubChem CID 4757044) has the molecular formula C29H31N2O5+ and a molecular weight of 487.58 g/mol. Its IUPAC name is 4-(4-methoxybenzoyl)-1-(3-morpholin-4-ium-4-ylpropyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione.
| Compound Name | 4-(4-methoxybenzoyl)-1-(3-morpholin-4-ium-4-ylpropyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4757044 |
| Molecular Formula | C29H31N2O5+ |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 4-(4-methoxybenzoyl)-1-(3-morpholin-4-ium-4-ylpropyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(CCC[NH+]3CCOCC3)C2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C29H30N2O5/c1-35-22-12-10-21(11-13-22)27(32)25-26(24-9-4-7-20-6-2-3-8-23(20)24)31(29(34)28(25)33)15-5-14-30-16-18-36-19-17-30/h2-4,6-13,25-26H,5,14-19H2,1H3/p+1 |
| InChIKey | MBXAMOYXQBOPNG-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|