C26H30ClN2O5+ — CID 4228512
4-(4-chlorobenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4228512) has the molecular formula C26H30ClN2O5+ and a molecular weight of 485.99 g/mol. Its IUPAC name is 4-(4-chlorobenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-(4-chlorobenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4228512 |
| Molecular Formula | C26H30ClN2O5+ |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 4-(4-chlorobenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CC(C)Oc1ccc(C2C(C(=O)c3ccc(Cl)cc3)C(=O)C(=O)N2CC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C26H29ClN2O5/c1-17(2)34-21-9-5-18(6-10-21)23-22(24(30)19-3-7-20(27)8-4-19)25(31)26(32)29(23)12-11-28-13-15-33-16-14-28/h3-10,17,22-23H,11-16H2,1-2H3/p+1 |
| InChIKey | WMGBJMRRYQIENX-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|