C23H23ClFN2O4+ — CID 4756541
5-(4-chlorophenyl)-4-(4-fluorobenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione (PubChem CID 4756541) has the molecular formula C23H23ClFN2O4+ and a molecular weight of 445.90 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-(4-fluorobenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-chlorophenyl)-4-(4-fluorobenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4756541 |
| Molecular Formula | C23H23ClFN2O4+ |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 5-(4-chlorophenyl)-4-(4-fluorobenzoyl)-1-(2-morpholin-4-ium-4-ylethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CC[NH+]2CCOCC2)C(c2ccc(Cl)cc2)C1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22ClFN2O4/c24-17-5-1-15(2-6-17)20-19(21(28)16-3-7-18(25)8-4-16)22(29)23(30)27(20)10-9-26-11-13-31-14-12-26/h1-8,19-20H,9-14H2/p+1 |
| InChIKey | ZOOXITFJBUCBME-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|