C24H29N3O4+2 — CID 7349304
(5R)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-phenyl-1-(2-piperazine-1,4-diium-1-ylethyl)pyrrolidine-2,3-dione (PubChem CID 7349304) has the molecular formula C24H29N3O4+2 and a molecular weight of 423.51 g/mol. Its IUPAC name is (5R)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-phenyl-1-(2-piperazine-1,4-diium-1-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-phenyl-1-(2-piperazine-1,4-diium-1-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 7349304 |
| Molecular Formula | C24H29N3O4+2 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (5R)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-phenyl-1-(2-piperazine-1,4-diium-1-ylethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(CC[NH+]3CC[NH2+]CC3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-31-19-9-7-18(8-10-19)22(28)20-21(17-5-3-2-4-6-17)27(24(30)23(20)29)16-15-26-13-11-25-12-14-26/h2-10,21,25,28H,11-16H2,1H3/p+2/t21-/m1/s1 |
| InChIKey | FMKJZDGSFDEOEF-OAQYLSRUSA-P |
| XLogP | -0.42 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|