C24H24NO6- — CID 7410020
6-[(5S)-4-[hydroxy-(4-methoxyphenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]hexanoate (PubChem CID 7410020) has the molecular formula C24H24NO6- and a molecular weight of 422.46 g/mol. Its IUPAC name is 6-[(5S)-4-[hydroxy-(4-methoxyphenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]hexanoate.
| Compound Name | 6-[(5S)-4-[hydroxy-(4-methoxyphenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 7410020 |
| Molecular Formula | C24H24NO6- |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 6-[(5S)-4-[hydroxy-(4-methoxyphenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]hexanoate |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(CCCCCC(=O)[O-])[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO6/c1-31-18-13-11-17(12-14-18)22(28)20-21(16-8-4-2-5-9-16)25(24(30)23(20)29)15-7-3-6-10-19(26)27/h2,4-5,8-9,11-14,21,28H,3,6-7,10,15H2,1H3,(H,26,27)/p-1/t21-/m0/s1 |
| InChIKey | BZVKNMLABBEXIX-NRFANRHFSA-M |
| XLogP | 2.43 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|