C23H23NO5 — CID 5310646
6-[(4E)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]hexanoic acid (PubChem CID 5310646) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 6-[(4E)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]hexanoic acid.
| Compound Name | 6-[(4E)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 5310646 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 6-[(4E)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C(=O)/C(=C(/O)c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C23H23NO5/c25-18(26)14-8-3-9-15-24-20(16-10-4-1-5-11-16)19(22(28)23(24)29)21(27)17-12-6-2-7-13-17/h1-2,4-7,10-13,20,27H,3,8-9,14-15H2,(H,25,26)/b21-19+ |
| InChIKey | MYAHNKUKRVMWRU-XUTLUUPISA-N |
| XLogP | 3.75 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|