C21H19NO5 — CID 5441843
4-[(4E,5R)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]butanoic acid (PubChem CID 5441843) has the molecular formula C21H19NO5 and a molecular weight of 365.38 g/mol. Its IUPAC name is 4-[(4E,5R)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]butanoic acid.
| Compound Name | 4-[(4E,5R)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 5441843 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 4-[(4E,5R)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=O)/C(=C(/O)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H19NO5/c23-16(24)12-7-13-22-18(14-8-3-1-4-9-14)17(20(26)21(22)27)19(25)15-10-5-2-6-11-15/h1-6,8-11,18,25H,7,12-13H2,(H,23,24)/b19-17+/t18-/m1/s1 |
| InChIKey | UPQVDYBLATZHIX-SELCWUDQSA-N |
| XLogP | 2.97 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|