C21H18ClNO5 — CID 5349101
4-[(4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]butanoic acid (PubChem CID 5349101) has the molecular formula C21H18ClNO5 and a molecular weight of 399.83 g/mol. Its IUPAC name is 4-[(4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]butanoic acid.
| Compound Name | 4-[(4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 5349101 |
| Molecular Formula | C21H18ClNO5 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 4-[(4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=O)/C(=C(\O)c2ccc(Cl)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C21H18ClNO5/c22-15-10-8-14(9-11-15)19(26)17-18(13-5-2-1-3-6-13)23(21(28)20(17)27)12-4-7-16(24)25/h1-3,5-6,8-11,18,26H,4,7,12H2,(H,24,25)/b19-17- |
| InChIKey | OFNGAAZNALFDGZ-ZPHPHTNESA-N |
| XLogP | 3.63 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|