C23H22ClNO5 — CID 98378645
6-[(2R,3E)-2-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid (PubChem CID 98378645) has the molecular formula C23H22ClNO5 and a molecular weight of 427.88 g/mol. Its IUPAC name is 6-[(2R,3E)-2-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid.
| Compound Name | 6-[(2R,3E)-2-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 98378645 |
| Molecular Formula | C23H22ClNO5 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 6-[(2R,3E)-2-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C(=O)/C(=C(/O)c2ccccc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClNO5/c24-17-12-10-15(11-13-17)20-19(21(28)16-7-3-1-4-8-16)22(29)23(30)25(20)14-6-2-5-9-18(26)27/h1,3-4,7-8,10-13,20,28H,2,5-6,9,14H2,(H,26,27)/b21-19+/t20-/m1/s1 |
| InChIKey | NLUXHGGVSHOLTL-YDJIHCHBSA-N |
| XLogP | 4.41 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|