C26H24N2O5 — CID 145485506
4-benzoyl-5-[4-(hydroxyamino)phenyl]-1-(4-prop-1-en-2-ylphenyl)pyrrolidine-2,3-dione;hydrate (PubChem CID 145485506) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-benzoyl-5-[4-(hydroxyamino)phenyl]-1-(4-prop-1-en-2-ylphenyl)pyrrolidine-2,3-dione;hydrate.
| Compound Name | 4-benzoyl-5-[4-(hydroxyamino)phenyl]-1-(4-prop-1-en-2-ylphenyl)pyrrolidine-2,3-dione;hydrate |
|---|---|
| PubChem CID | 145485506 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 4-benzoyl-5-[4-(hydroxyamino)phenyl]-1-(4-prop-1-en-2-ylphenyl)pyrrolidine-2,3-dione;hydrate |
| SMILES | C=C(C)c1ccc(N2C(=O)C(=O)C(C(=O)c3ccccc3)C2c2ccc(NO)cc2)cc1.O |
| InChI | InChI=1S/C26H22N2O4.H2O/c1-16(2)17-10-14-21(15-11-17)28-23(18-8-12-20(27-32)13-9-18)22(25(30)26(28)31)24(29)19-6-4-3-5-7-19;/h3-15,22-23,27,32H,1H2,2H3;1H2 |
| InChIKey | LHROFVRUTAYKGW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|