C22H18N2O3S — CID 123298980
4-(4-methylbenzoyl)-5-(4-methylphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 123298980) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is 4-(4-methylbenzoyl)-5-(4-methylphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-(4-methylbenzoyl)-5-(4-methylphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123298980 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 4-(4-methylbenzoyl)-5-(4-methylphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C(=O)C2C(=O)C(=O)N(c3nccs3)C2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H18N2O3S/c1-13-3-7-15(8-4-13)18-17(19(25)16-9-5-14(2)6-10-16)20(26)21(27)24(18)22-23-11-12-28-22/h3-12,17-18H,1-2H3 |
| InChIKey | UYSVEBDCHOSPJG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|