C20H15N3O3S — CID 4747707
4-benzoyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-phenylpyrrolidine-2,3-dione (PubChem CID 4747707) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is 4-benzoyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-phenylpyrrolidine-2,3-dione.
| Compound Name | 4-benzoyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4747707 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-benzoyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-phenylpyrrolidine-2,3-dione |
| SMILES | Cc1nnc(N2C(=O)C(=O)C(C(=O)c3ccccc3)C2c2ccccc2)s1 |
| InChI | InChI=1S/C20H15N3O3S/c1-12-21-22-20(27-12)23-16(13-8-4-2-5-9-13)15(18(25)19(23)26)17(24)14-10-6-3-7-11-14/h2-11,15-16H,1H3 |
| InChIKey | RZFIJYDXZAHUBY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|