C24H22N4O5S — CID 123205937
3-[3-(4-methoxybenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]-N,N-dimethylbenzamide (PubChem CID 123205937) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is 3-[3-(4-methoxybenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]-N,N-dimethylbenzamide.
| Compound Name | 3-[3-(4-methoxybenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 123205937 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-[3-(4-methoxybenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(c3nnc(C)s3)C2c2cccc(C(=O)N(C)C)c2)cc1 |
| InChI | InChI=1S/C24H22N4O5S/c1-13-25-26-24(34-13)28-19(15-6-5-7-16(12-15)22(31)27(2)3)18(21(30)23(28)32)20(29)14-8-10-17(33-4)11-9-14/h5-12,18-19H,1-4H3 |
| InChIKey | SJKWDUNKTHCDIP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|