C23H20N4O5S — CID 123209083
3-[3-(4-methoxybenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]-N-methylbenzamide (PubChem CID 123209083) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is 3-[3-(4-methoxybenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]-N-methylbenzamide.
| Compound Name | 3-[3-(4-methoxybenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 123209083 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 3-[3-(4-methoxybenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(C2C(C(=O)c3ccc(OC)cc3)C(=O)C(=O)N2c2nnc(C)s2)c1 |
| InChI | InChI=1S/C23H20N4O5S/c1-12-25-26-23(33-12)27-18(14-5-4-6-15(11-14)21(30)24-2)17(20(29)22(27)31)19(28)13-7-9-16(32-3)10-8-13/h4-11,17-18H,1-3H3,(H,24,30) |
| InChIKey | LCMOLUFJPLYMRW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|