C26H20N2O5S — CID 3383739
1-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxybenzoyl)-5-phenylpyrrolidine-2,3-dione (PubChem CID 3383739) has the molecular formula C26H20N2O5S and a molecular weight of 472.52 g/mol. Its IUPAC name is 1-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxybenzoyl)-5-phenylpyrrolidine-2,3-dione.
| Compound Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxybenzoyl)-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3383739 |
| Molecular Formula | C26H20N2O5S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxybenzoyl)-5-phenylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(c3nc4ccc(OC)cc4s3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H20N2O5S/c1-32-17-10-8-16(9-11-17)23(29)21-22(15-6-4-3-5-7-15)28(25(31)24(21)30)26-27-19-13-12-18(33-2)14-20(19)34-26/h3-14,21-22H,1-2H3 |
| InChIKey | FXRYSFSGKKYBJC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|