C25H22N2O6S — CID 4747489
ethyl 2-[3-benzoyl-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4747489) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is ethyl 2-[3-benzoyl-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[3-benzoyl-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4747489 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | ethyl 2-[3-benzoyl-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)C(=O)C(C(=O)c3ccccc3)C2c2ccc(OC)cc2)nc1C |
| InChI | InChI=1S/C25H22N2O6S/c1-4-33-24(31)22-14(2)26-25(34-22)27-19(15-10-12-17(32-3)13-11-15)18(21(29)23(27)30)20(28)16-8-6-5-7-9-16/h5-13,18-19H,4H2,1-3H3 |
| InChIKey | VRRXRCBWVFHLIC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|